ChemNet > CAS > 499785-49-8 1-ethyl 4-(2-oxo-1,2-diphenylethyl) succinate
499785-49-8 1-ethyl 4-(2-oxo-1,2-diphenylethyl) succinate
상품명칭 |
1-ethyl 4-(2-oxo-1,2-diphenylethyl) succinate |
별명 |
ethyl 2-oxo-1,2-diphenylethyl butanedioate |
분자식 |
C20H20O5 |
분자량 |
340.3698 |
InChI |
InChI=1/C20H20O5/c1-2-24-17(21)13-14-18(22)25-20(16-11-7-4-8-12-16)19(23)15-9-5-3-6-10-15/h3-12,20H,2,13-14H2,1H3 |
cas번호 |
499785-49-8 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
녹는 점 |
46℃ |
비등점 |
469.7°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
205.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|